C32H28N2O6S — CID 124539221
[4-[(Z)-[(11S)-11-(3,4-dimethoxyphenyl)-13-oxo-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-14-ylidene]methyl]-2-methoxyphenyl] acetate (PubChem CID 124539221) has the molecular formula C32H28N2O6S and a molecular weight of 568.65 g/mol. Its IUPAC name is [4-[(Z)-[(11S)-11-(3,4-dimethoxyphenyl)-13-oxo-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-14-ylidene]methyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[(Z)-[(11S)-11-(3,4-dimethoxyphenyl)-13-oxo-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-14-ylidene]methyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 124539221 |
| Molecular Formula | C32H28N2O6S |
| Molecular Weight | 568.65 g/mol |
| Exact Mass | 568.17 |
| IUPAC Name | [4-[(Z)-[(11S)-11-(3,4-dimethoxyphenyl)-13-oxo-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-14-ylidene]methyl]-2-methoxyphenyl] acetate |
| SMILES | COc1ccc([C@H]2C3=C(N=c4s/c(=C\c5ccc(OC(C)=O)c(OC)c5)c(=O)n42)c2ccccc2CC3)cc1OC |
| InChI | InChI=1S/C32H28N2O6S/c1-18(35)40-25-13-9-19(15-26(25)38-3)16-28-31(36)34-30(21-11-14-24(37-2)27(17-21)39-4)23-12-10-20-7-5-6-8-22(20)29(23)33-32(34)41-28/h5-9,11,13-17,30H,10,12H2,1-4H3/b28-16-/t30-/m0/s1 |
| InChIKey | CAVPDSSQFDZIKH-TZUCAZQYSA-N |
| XLogP | 4.27 |
| TPSA | 88.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.65 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|