C29H23FN2O3S — CID 124631269
(11R,14Z)-11-(3,4-dimethoxyphenyl)-14-[(4-fluorophenyl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 124631269) has the molecular formula C29H23FN2O3S and a molecular weight of 498.58 g/mol. Its IUPAC name is (11R,14Z)-11-(3,4-dimethoxyphenyl)-14-[(4-fluorophenyl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (11R,14Z)-11-(3,4-dimethoxyphenyl)-14-[(4-fluorophenyl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 124631269 |
| Molecular Formula | C29H23FN2O3S |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | (11R,14Z)-11-(3,4-dimethoxyphenyl)-14-[(4-fluorophenyl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | COc1ccc([C@@H]2C3=C(N=c4s/c(=C\c5ccc(F)cc5)c(=O)n42)c2ccccc2CC3)cc1OC |
| InChI | InChI=1S/C29H23FN2O3S/c1-34-23-14-10-19(16-24(23)35-2)27-22-13-9-18-5-3-4-6-21(18)26(22)31-29-32(27)28(33)25(36-29)15-17-7-11-20(30)12-8-17/h3-8,10-12,14-16,27H,9,13H2,1-2H3/b25-15-/t27-/m1/s1 |
| InChIKey | VGGZMDMBRFCNPD-SUAMDDGLSA-N |
| XLogP | 4.47 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |