C28H20FIN2O2S — CID 124531236
(11S,14Z)-11-(4-fluorophenyl)-14-[(3-iodo-4-methoxyphenyl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 124531236) has the molecular formula C28H20FIN2O2S and a molecular weight of 594.45 g/mol. Its IUPAC name is (11S,14Z)-11-(4-fluorophenyl)-14-[(3-iodo-4-methoxyphenyl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (11S,14Z)-11-(4-fluorophenyl)-14-[(3-iodo-4-methoxyphenyl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 124531236 |
| Molecular Formula | C28H20FIN2O2S |
| Molecular Weight | 594.45 g/mol |
| Exact Mass | 594.03 |
| IUPAC Name | (11S,14Z)-11-(4-fluorophenyl)-14-[(3-iodo-4-methoxyphenyl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | COc1ccc(/C=c2\sc3n(c2=O)[C@@H](c2ccc(F)cc2)C2=C(N=3)c3ccccc3CC2)cc1I |
| InChI | InChI=1S/C28H20FIN2O2S/c1-34-23-13-6-16(14-22(23)30)15-24-27(33)32-26(18-7-10-19(29)11-8-18)21-12-9-17-4-2-3-5-20(17)25(21)31-28(32)35-24/h2-8,10-11,13-15,26H,9,12H2,1H3/b24-15-/t26-/m0/s1 |
| InChIKey | UNPRTALLXKUTSP-RISWYLRJSA-N |
| XLogP | 5.07 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|