C28H19FI2N2O2S — CID 124602646
(11S,14E)-14-[(3,5-diiodo-4-methoxyphenyl)methylidene]-11-(4-fluorophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 124602646) has the molecular formula C28H19FI2N2O2S and a molecular weight of 720.35 g/mol. Its IUPAC name is (11S,14E)-14-[(3,5-diiodo-4-methoxyphenyl)methylidene]-11-(4-fluorophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (11S,14E)-14-[(3,5-diiodo-4-methoxyphenyl)methylidene]-11-(4-fluorophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 124602646 |
| Molecular Formula | C28H19FI2N2O2S |
| Molecular Weight | 720.35 g/mol |
| Exact Mass | 719.92 |
| IUPAC Name | (11S,14E)-14-[(3,5-diiodo-4-methoxyphenyl)methylidene]-11-(4-fluorophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | COc1c(I)cc(/C=c2/sc3n(c2=O)[C@@H](c2ccc(F)cc2)C2=C(N=3)c3ccccc3CC2)cc1I |
| InChI | InChI=1S/C28H19FI2N2O2S/c1-35-26-21(30)12-15(13-22(26)31)14-23-27(34)33-25(17-6-9-18(29)10-7-17)20-11-8-16-4-2-3-5-19(16)24(20)32-28(33)36-23/h2-7,9-10,12-14,25H,8,11H2,1H3/b23-14+/t25-/m0/s1 |
| InChIKey | GQPFCHRKVJUNEJ-ZDGAQAAHSA-N |
| XLogP | 5.68 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.35 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|