C34H22FI2N3O4S — CID 99686287
(11R,14Z)-14-[[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-11-(4-fluorophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 99686287) has the molecular formula C34H22FI2N3O4S and a molecular weight of 841.44 g/mol. Its IUPAC name is (11R,14Z)-14-[[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-11-(4-fluorophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (11R,14Z)-14-[[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-11-(4-fluorophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 99686287 |
| Molecular Formula | C34H22FI2N3O4S |
| Molecular Weight | 841.44 g/mol |
| Exact Mass | 840.94 |
| IUPAC Name | (11R,14Z)-14-[[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-11-(4-fluorophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | O=c1/c(=C/c2cc(I)c(OCc3ccc([N+](=O)[O-])cc3)c(I)c2)sc2n1[C@H](c1ccc(F)cc1)C1=C(N=2)c2ccccc2CC1 |
| InChI | InChI=1S/C34H22FI2N3O4S/c35-23-10-7-22(8-11-23)31-26-14-9-21-3-1-2-4-25(21)30(26)38-34-39(31)33(41)29(45-34)17-20-15-27(36)32(28(37)16-20)44-18-19-5-12-24(13-6-19)40(42)43/h1-8,10-13,15-17,31H,9,14,18H2/b29-17-/t31-/m1/s1 |
| InChIKey | FXMNXLWOKSORKO-QQMBNGEASA-N |
| XLogP | 7.15 |
| TPSA | 86.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.44 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|