C35H26I2N2O3S — CID 124597156
(11R,14Z)-14-[(3,5-diiodo-4-phenylmethoxyphenyl)methylidene]-11-(2-methoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 124597156) has the molecular formula C35H26I2N2O3S and a molecular weight of 808.48 g/mol. Its IUPAC name is (11R,14Z)-14-[(3,5-diiodo-4-phenylmethoxyphenyl)methylidene]-11-(2-methoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (11R,14Z)-14-[(3,5-diiodo-4-phenylmethoxyphenyl)methylidene]-11-(2-methoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 124597156 |
| Molecular Formula | C35H26I2N2O3S |
| Molecular Weight | 808.48 g/mol |
| Exact Mass | 807.98 |
| IUPAC Name | (11R,14Z)-14-[(3,5-diiodo-4-phenylmethoxyphenyl)methylidene]-11-(2-methoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | COc1ccccc1[C@H]1C2=C(N=c3s/c(=C\c4cc(I)c(OCc5ccccc5)c(I)c4)c(=O)n31)c1ccccc1CC2 |
| InChI | InChI=1S/C35H26I2N2O3S/c1-41-29-14-8-7-13-25(29)32-26-16-15-23-11-5-6-12-24(23)31(26)38-35-39(32)34(40)30(43-35)19-22-17-27(36)33(28(37)18-22)42-20-21-9-3-2-4-10-21/h2-14,17-19,32H,15-16,20H2,1H3/b30-19-/t32-/m0/s1 |
| InChIKey | ZIIMALGCTSVRLY-ISZRBDKASA-N |
| XLogP | 7.12 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.48 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|