C35H27N3O5S — CID 124538736
(11S,14Z)-11-(2-methoxyphenyl)-14-[[4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 124538736) has the molecular formula C35H27N3O5S and a molecular weight of 601.68 g/mol. Its IUPAC name is (11S,14Z)-11-(2-methoxyphenyl)-14-[[4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (11S,14Z)-11-(2-methoxyphenyl)-14-[[4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 124538736 |
| Molecular Formula | C35H27N3O5S |
| Molecular Weight | 601.68 g/mol |
| Exact Mass | 601.17 |
| IUPAC Name | (11S,14Z)-11-(2-methoxyphenyl)-14-[[4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | COc1ccccc1[C@@H]1C2=C(N=c3s/c(=C\c4ccc(OCc5ccc([N+](=O)[O-])cc5)cc4)c(=O)n31)c1ccccc1CC2 |
| InChI | InChI=1S/C35H27N3O5S/c1-42-30-9-5-4-8-28(30)33-29-19-14-24-6-2-3-7-27(24)32(29)36-35-37(33)34(39)31(44-35)20-22-12-17-26(18-13-22)43-21-23-10-15-25(16-11-23)38(40)41/h2-13,15-18,20,33H,14,19,21H2,1H3/b31-20-/t33-/m1/s1 |
| InChIKey | ZBTFBCUDFJWSTQ-WXKAHTKJSA-N |
| XLogP | 5.81 |
| TPSA | 95.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.68 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|