C28H21IN2O2S — CID 124582950
(11S,14Z)-14-[(3-iodophenyl)methylidene]-11-(2-methoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 124582950) has the molecular formula C28H21IN2O2S and a molecular weight of 576.46 g/mol. Its IUPAC name is (11S,14Z)-14-[(3-iodophenyl)methylidene]-11-(2-methoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (11S,14Z)-14-[(3-iodophenyl)methylidene]-11-(2-methoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 124582950 |
| Molecular Formula | C28H21IN2O2S |
| Molecular Weight | 576.46 g/mol |
| Exact Mass | 576.04 |
| IUPAC Name | (11S,14Z)-14-[(3-iodophenyl)methylidene]-11-(2-methoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | COc1ccccc1[C@@H]1C2=C(N=c3s/c(=C\c4cccc(I)c4)c(=O)n31)c1ccccc1CC2 |
| InChI | InChI=1S/C28H21IN2O2S/c1-33-23-12-5-4-11-21(23)26-22-14-13-18-8-2-3-10-20(18)25(22)30-28-31(26)27(32)24(34-28)16-17-7-6-9-19(29)15-17/h2-12,15-16,26H,13-14H2,1H3/b24-16-/t26-/m1/s1 |
| InChIKey | RXBIQVXTAKQVKR-GTWFGUSFSA-N |
| XLogP | 4.93 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|