C30H26BrN3O2S — CID 124538780
(11R,14Z)-14-[[3-bromo-4-(dimethylamino)phenyl]methylidene]-11-(2-methoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 124538780) has the molecular formula C30H26BrN3O2S and a molecular weight of 572.53 g/mol. Its IUPAC name is (11R,14Z)-14-[[3-bromo-4-(dimethylamino)phenyl]methylidene]-11-(2-methoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (11R,14Z)-14-[[3-bromo-4-(dimethylamino)phenyl]methylidene]-11-(2-methoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 124538780 |
| Molecular Formula | C30H26BrN3O2S |
| Molecular Weight | 572.53 g/mol |
| Exact Mass | 571.09 |
| IUPAC Name | (11R,14Z)-14-[[3-bromo-4-(dimethylamino)phenyl]methylidene]-11-(2-methoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | COc1ccccc1[C@H]1C2=C(N=c3s/c(=C\c4ccc(N(C)C)c(Br)c4)c(=O)n31)c1ccccc1CC2 |
| InChI | InChI=1S/C30H26BrN3O2S/c1-33(2)24-15-12-18(16-23(24)31)17-26-29(35)34-28(21-10-6-7-11-25(21)36-3)22-14-13-19-8-4-5-9-20(19)27(22)32-30(34)37-26/h4-12,15-17,28H,13-14H2,1-3H3/b26-17-/t28-/m0/s1 |
| InChIKey | OWLMXRAPXIGHJM-ASZNLBCTSA-N |
| XLogP | 5.16 |
| TPSA | 46.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.53 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|