C37H30N2O6S — CID 124597733
[4-[(Z)-[(11S)-11-(3,4-dimethoxyphenyl)-13-oxo-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-14-ylidene]methyl]phenyl] 4-methoxybenzoate (PubChem CID 124597733) has the molecular formula C37H30N2O6S and a molecular weight of 630.72 g/mol. Its IUPAC name is [4-[(Z)-[(11S)-11-(3,4-dimethoxyphenyl)-13-oxo-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-14-ylidene]methyl]phenyl] 4-methoxybenzoate.
| Compound Name | [4-[(Z)-[(11S)-11-(3,4-dimethoxyphenyl)-13-oxo-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-14-ylidene]methyl]phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 124597733 |
| Molecular Formula | C37H30N2O6S |
| Molecular Weight | 630.72 g/mol |
| Exact Mass | 630.18 |
| IUPAC Name | [4-[(Z)-[(11S)-11-(3,4-dimethoxyphenyl)-13-oxo-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-14-ylidene]methyl]phenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(/C=c3\sc4n(c3=O)[C@@H](c3ccc(OC)c(OC)c3)C3=C(N=4)c4ccccc4CC3)cc2)cc1 |
| InChI | InChI=1S/C37H30N2O6S/c1-42-26-16-10-24(11-17-26)36(41)45-27-14-8-22(9-15-27)20-32-35(40)39-34(25-13-19-30(43-2)31(21-25)44-3)29-18-12-23-6-4-5-7-28(23)33(29)38-37(39)46-32/h4-11,13-17,19-21,34H,12,18H2,1-3H3/b32-20-/t34-/m0/s1 |
| InChIKey | MCTVEYHGLJEKIL-ZSXMQSLNSA-N |
| XLogP | 5.56 |
| TPSA | 88.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.72 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|