C28H21N3O5S — CID 124582933
(11S,14Z)-14-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-11-phenyl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 124582933) has the molecular formula C28H21N3O5S and a molecular weight of 511.56 g/mol. Its IUPAC name is (11S,14Z)-14-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-11-phenyl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (11S,14Z)-14-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-11-phenyl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 124582933 |
| Molecular Formula | C28H21N3O5S |
| Molecular Weight | 511.56 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | (11S,14Z)-14-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-11-phenyl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | COc1cc(/C=c2\sc3n(c2=O)[C@@H](c2ccccc2)C2=C(N=3)c3ccccc3CC2)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C28H21N3O5S/c1-36-22-14-16(13-21(26(22)32)31(34)35)15-23-27(33)30-25(18-8-3-2-4-9-18)20-12-11-17-7-5-6-10-19(17)24(20)29-28(30)37-23/h2-10,13-15,25,32H,11-12H2,1H3/b23-15-/t25-/m0/s1 |
| InChIKey | PAAINQNZWYXLQK-GJFKPFFXSA-N |
| XLogP | 3.94 |
| TPSA | 106.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.56 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|