C29H23N3O4S — CID 23832564
14-[(4-methoxy-3-nitrophenyl)methylidene]-11-(4-methylphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 23832564) has the molecular formula C29H23N3O4S and a molecular weight of 509.59 g/mol. Its IUPAC name is 14-[(4-methoxy-3-nitrophenyl)methylidene]-11-(4-methylphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | 14-[(4-methoxy-3-nitrophenyl)methylidene]-11-(4-methylphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 23832564 |
| Molecular Formula | C29H23N3O4S |
| Molecular Weight | 509.59 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | 14-[(4-methoxy-3-nitrophenyl)methylidene]-11-(4-methylphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | COc1ccc(C=c2sc3n(c2=O)C(c2ccc(C)cc2)C2=C(N=3)c3ccccc3CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H23N3O4S/c1-17-7-10-20(11-8-17)27-22-13-12-19-5-3-4-6-21(19)26(22)30-29-31(27)28(33)25(37-29)16-18-9-14-24(36-2)23(15-18)32(34)35/h3-11,14-16,27H,12-13H2,1-2H3 |
| InChIKey | MLKOYZHWERJIQK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 86.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.59 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|