C30H26N2O3S — CID 23944710
11-(2,5-dimethoxyphenyl)-14-[(4-methylphenyl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 23944710) has the molecular formula C30H26N2O3S and a molecular weight of 494.62 g/mol. Its IUPAC name is 11-(2,5-dimethoxyphenyl)-14-[(4-methylphenyl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | 11-(2,5-dimethoxyphenyl)-14-[(4-methylphenyl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 23944710 |
| Molecular Formula | C30H26N2O3S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 11-(2,5-dimethoxyphenyl)-14-[(4-methylphenyl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | COc1ccc(OC)c(C2C3=C(N=c4sc(=Cc5ccc(C)cc5)c(=O)n42)c2ccccc2CC3)c1 |
| InChI | InChI=1S/C30H26N2O3S/c1-18-8-10-19(11-9-18)16-26-29(33)32-28(24-17-21(34-2)13-15-25(24)35-3)23-14-12-20-6-4-5-7-22(20)27(23)31-30(32)36-26/h4-11,13,15-17,28H,12,14H2,1-3H3 |
| InChIKey | MACXQUMDFODPSL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |