C28H22N2OS — CID 124631004
(11S,14Z)-14-[(4-methylphenyl)methylidene]-11-phenyl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 124631004) has the molecular formula C28H22N2OS and a molecular weight of 434.56 g/mol. Its IUPAC name is (11S,14Z)-14-[(4-methylphenyl)methylidene]-11-phenyl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (11S,14Z)-14-[(4-methylphenyl)methylidene]-11-phenyl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 124631004 |
| Molecular Formula | C28H22N2OS |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | (11S,14Z)-14-[(4-methylphenyl)methylidene]-11-phenyl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | Cc1ccc(/C=c2\sc3n(c2=O)[C@@H](c2ccccc2)C2=C(N=3)c3ccccc3CC2)cc1 |
| InChI | InChI=1S/C28H22N2OS/c1-18-11-13-19(14-12-18)17-24-27(31)30-26(21-8-3-2-4-9-21)23-16-15-20-7-5-6-10-22(20)25(23)29-28(30)32-24/h2-14,17,26H,15-16H2,1H3/b24-17-/t26-/m0/s1 |
| InChIKey | KPHZLBPAMNJRLC-FCYPAOMHSA-N |
| XLogP | 4.63 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |