C28H22N2O2S — CID 23832509
14-[(3-methoxyphenyl)methylidene]-11-phenyl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 23832509) has the molecular formula C28H22N2O2S and a molecular weight of 450.56 g/mol. Its IUPAC name is 14-[(3-methoxyphenyl)methylidene]-11-phenyl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | 14-[(3-methoxyphenyl)methylidene]-11-phenyl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 23832509 |
| Molecular Formula | C28H22N2O2S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 14-[(3-methoxyphenyl)methylidene]-11-phenyl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | COc1cccc(C=c2sc3n(c2=O)C(c2ccccc2)C2=C(N=3)c3ccccc3CC2)c1 |
| InChI | InChI=1S/C28H22N2O2S/c1-32-21-12-7-8-18(16-21)17-24-27(31)30-26(20-10-3-2-4-11-20)23-15-14-19-9-5-6-13-22(19)25(23)29-28(30)33-24/h2-13,16-17,26H,14-15H2,1H3 |
| InChIKey | YKOOLWIWYIGRTG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |