C30H27N3O2S — CID 23916752
14-[[4-(dimethylamino)phenyl]methylidene]-11-(3-methoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 23916752) has the molecular formula C30H27N3O2S and a molecular weight of 493.63 g/mol. Its IUPAC name is 14-[[4-(dimethylamino)phenyl]methylidene]-11-(3-methoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | 14-[[4-(dimethylamino)phenyl]methylidene]-11-(3-methoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 23916752 |
| Molecular Formula | C30H27N3O2S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 14-[[4-(dimethylamino)phenyl]methylidene]-11-(3-methoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | COc1cccc(C2C3=C(N=c4sc(=Cc5ccc(N(C)C)cc5)c(=O)n42)c2ccccc2CC3)c1 |
| InChI | InChI=1S/C30H27N3O2S/c1-32(2)22-14-11-19(12-15-22)17-26-29(34)33-28(21-8-6-9-23(18-21)35-3)25-16-13-20-7-4-5-10-24(20)27(25)31-30(33)36-26/h4-12,14-15,17-18,28H,13,16H2,1-3H3 |
| InChIKey | MULMBVXOHZMLBD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 46.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|