C32H31N3O2S — CID 23860946
14-[[4-(diethylamino)phenyl]methylidene]-11-(4-methoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 23860946) has the molecular formula C32H31N3O2S and a molecular weight of 521.69 g/mol. Its IUPAC name is 14-[[4-(diethylamino)phenyl]methylidene]-11-(4-methoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | 14-[[4-(diethylamino)phenyl]methylidene]-11-(4-methoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 23860946 |
| Molecular Formula | C32H31N3O2S |
| Molecular Weight | 521.69 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | 14-[[4-(diethylamino)phenyl]methylidene]-11-(4-methoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | CCN(CC)c1ccc(C=c2sc3n(c2=O)C(c2ccc(OC)cc2)C2=C(N=3)c3ccccc3CC2)cc1 |
| InChI | InChI=1S/C32H31N3O2S/c1-4-34(5-2)24-15-10-21(11-16-24)20-28-31(36)35-30(23-12-17-25(37-3)18-13-23)27-19-14-22-8-6-7-9-26(22)29(27)33-32(35)38-28/h6-13,15-18,20,30H,4-5,14,19H2,1-3H3 |
| InChIKey | DFNCDNWMKGAXGF-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 46.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.69 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|