C31H28ClN3OS — CID 23972749
11-(2-chlorophenyl)-14-[[4-(diethylamino)phenyl]methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 23972749) has the molecular formula C31H28ClN3OS and a molecular weight of 526.11 g/mol. Its IUPAC name is 11-(2-chlorophenyl)-14-[[4-(diethylamino)phenyl]methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | 11-(2-chlorophenyl)-14-[[4-(diethylamino)phenyl]methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 23972749 |
| Molecular Formula | C31H28ClN3OS |
| Molecular Weight | 526.11 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | 11-(2-chlorophenyl)-14-[[4-(diethylamino)phenyl]methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | CCN(CC)c1ccc(C=c2sc3n(c2=O)C(c2ccccc2Cl)C2=C(N=3)c3ccccc3CC2)cc1 |
| InChI | InChI=1S/C31H28ClN3OS/c1-3-34(4-2)22-16-13-20(14-17-22)19-27-30(36)35-29(24-11-7-8-12-26(24)32)25-18-15-21-9-5-6-10-23(21)28(25)33-31(35)37-27/h5-14,16-17,19,29H,3-4,15,18H2,1-2H3 |
| InChIKey | ANDBAXUOGNWSSI-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.11 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|