C27H17ClN4O6S — CID 2720647
(11R,14E)-11-(2-chlorophenyl)-14-[(4-hydroxy-3,5-dinitrophenyl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 2720647) has the molecular formula C27H17ClN4O6S and a molecular weight of 560.98 g/mol. Its IUPAC name is (11R,14E)-11-(2-chlorophenyl)-14-[(4-hydroxy-3,5-dinitrophenyl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (11R,14E)-11-(2-chlorophenyl)-14-[(4-hydroxy-3,5-dinitrophenyl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 2720647 |
| Molecular Formula | C27H17ClN4O6S |
| Molecular Weight | 560.98 g/mol |
| Exact Mass | 560.06 |
| IUPAC Name | (11R,14E)-11-(2-chlorophenyl)-14-[(4-hydroxy-3,5-dinitrophenyl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | O=c1/c(=C\c2cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c2)sc2n1[C@@H](c1ccccc1Cl)C1=C(N=2)c2ccccc2CC1 |
| InChI | InChI=1S/C27H17ClN4O6S/c28-19-8-4-3-7-17(19)24-18-10-9-15-5-1-2-6-16(15)23(18)29-27-30(24)26(34)22(39-27)13-14-11-20(31(35)36)25(33)21(12-14)32(37)38/h1-8,11-13,24,33H,9-10H2/b22-13+/t24-/m0/s1 |
| InChIKey | PBHGXBNQDOOHBR-JGTYQCAFSA-N |
| XLogP | 4.49 |
| TPSA | 140.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.98 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|