C26H19N3O5S2 — CID 124581240
(11R,14E)-14-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-11-thiophen-2-yl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 124581240) has the molecular formula C26H19N3O5S2 and a molecular weight of 517.59 g/mol. Its IUPAC name is (11R,14E)-14-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-11-thiophen-2-yl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (11R,14E)-14-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-11-thiophen-2-yl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 124581240 |
| Molecular Formula | C26H19N3O5S2 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.08 |
| IUPAC Name | (11R,14E)-14-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-11-thiophen-2-yl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | COc1cc(/C=c2/sc3n(c2=O)[C@@H](c2cccs2)C2=C(N=3)c3ccccc3CC2)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C26H19N3O5S2/c1-34-19-12-14(11-18(24(19)30)29(32)33)13-21-25(31)28-23(20-7-4-10-35-20)17-9-8-15-5-2-3-6-16(15)22(17)27-26(28)36-21/h2-7,10-13,23,30H,8-9H2,1H3/b21-13+/t23-/m1/s1 |
| InChIKey | DYOBHMPSMBIRPW-FJWZAKCXSA-N |
| XLogP | 4.00 |
| TPSA | 106.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|