C29H22IN3O6S — CID 99660358
(11R,14Z)-11-(3,4-dimethoxyphenyl)-14-[(4-hydroxy-3-iodo-5-nitrophenyl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 99660358) has the molecular formula C29H22IN3O6S and a molecular weight of 667.48 g/mol. Its IUPAC name is (11R,14Z)-11-(3,4-dimethoxyphenyl)-14-[(4-hydroxy-3-iodo-5-nitrophenyl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (11R,14Z)-11-(3,4-dimethoxyphenyl)-14-[(4-hydroxy-3-iodo-5-nitrophenyl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 99660358 |
| Molecular Formula | C29H22IN3O6S |
| Molecular Weight | 667.48 g/mol |
| Exact Mass | 667.03 |
| IUPAC Name | (11R,14Z)-11-(3,4-dimethoxyphenyl)-14-[(4-hydroxy-3-iodo-5-nitrophenyl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | COc1ccc([C@@H]2C3=C(N=c4s/c(=C\c5cc(I)c(O)c([N+](=O)[O-])c5)c(=O)n42)c2ccccc2CC3)cc1OC |
| InChI | InChI=1S/C29H22IN3O6S/c1-38-22-10-8-17(14-23(22)39-2)26-19-9-7-16-5-3-4-6-18(16)25(19)31-29-32(26)28(35)24(40-29)13-15-11-20(30)27(34)21(12-15)33(36)37/h3-6,8,10-14,26,34H,7,9H2,1-2H3/b24-13-/t26-/m1/s1 |
| InChIKey | AAQYPDGCCIQPHX-NFYDWNOTSA-N |
| XLogP | 4.55 |
| TPSA | 116.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|