C29H22I2N2O4S — CID 124597634
(11S,14E)-11-(3,4-dimethoxyphenyl)-14-[(2-hydroxy-3,5-diiodophenyl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 124597634) has the molecular formula C29H22I2N2O4S and a molecular weight of 748.38 g/mol. Its IUPAC name is (11S,14E)-11-(3,4-dimethoxyphenyl)-14-[(2-hydroxy-3,5-diiodophenyl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (11S,14E)-11-(3,4-dimethoxyphenyl)-14-[(2-hydroxy-3,5-diiodophenyl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 124597634 |
| Molecular Formula | C29H22I2N2O4S |
| Molecular Weight | 748.38 g/mol |
| Exact Mass | 747.94 |
| IUPAC Name | (11S,14E)-11-(3,4-dimethoxyphenyl)-14-[(2-hydroxy-3,5-diiodophenyl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | COc1ccc([C@H]2C3=C(N=c4s/c(=C/c5cc(I)cc(I)c5O)c(=O)n42)c2ccccc2CC3)cc1OC |
| InChI | InChI=1S/C29H22I2N2O4S/c1-36-22-10-8-16(12-23(22)37-2)26-20-9-7-15-5-3-4-6-19(15)25(20)32-29-33(26)28(35)24(38-29)13-17-11-18(30)14-21(31)27(17)34/h3-6,8,10-14,26,34H,7,9H2,1-2H3/b24-13+/t26-/m0/s1 |
| InChIKey | OCAFMEXETOBVJN-LNXFQTKESA-N |
| XLogP | 5.25 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.38 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|