C31H27N3O7S — CID 124539195
(11R,14Z)-14-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-11-(3,4-dimethoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 124539195) has the molecular formula C31H27N3O7S and a molecular weight of 585.64 g/mol. Its IUPAC name is (11R,14Z)-14-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-11-(3,4-dimethoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (11R,14Z)-14-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-11-(3,4-dimethoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 124539195 |
| Molecular Formula | C31H27N3O7S |
| Molecular Weight | 585.64 g/mol |
| Exact Mass | 585.16 |
| IUPAC Name | (11R,14Z)-14-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-11-(3,4-dimethoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | COc1ccc([C@@H]2C3=C(N=c4s/c(=C\c5cc(OC)c(OC)cc5[N+](=O)[O-])c(=O)n42)c2ccccc2CC3)cc1OC |
| InChI | InChI=1S/C31H27N3O7S/c1-38-23-12-10-18(13-24(23)39-2)29-21-11-9-17-7-5-6-8-20(17)28(21)32-31-33(29)30(35)27(42-31)15-19-14-25(40-3)26(41-4)16-22(19)34(36)37/h5-8,10,12-16,29H,9,11H2,1-4H3/b27-15-/t29-/m1/s1 |
| InChIKey | VMSJPLVTGMEFIF-QUNTYYFUSA-N |
| XLogP | 4.26 |
| TPSA | 114.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.64 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|