C33H24ClN3O6S — CID 124597631
(11R,14E)-14-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylidene]-11-(3,4-dimethoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 124597631) has the molecular formula C33H24ClN3O6S and a molecular weight of 626.09 g/mol. Its IUPAC name is (11R,14E)-14-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylidene]-11-(3,4-dimethoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (11R,14E)-14-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylidene]-11-(3,4-dimethoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 124597631 |
| Molecular Formula | C33H24ClN3O6S |
| Molecular Weight | 626.09 g/mol |
| Exact Mass | 625.11 |
| IUPAC Name | (11R,14E)-14-[[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylidene]-11-(3,4-dimethoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | COc1ccc([C@@H]2C3=C(N=c4s/c(=C/c5ccc(-c6ccc(Cl)cc6[N+](=O)[O-])o5)c(=O)n42)c2ccccc2CC3)cc1OC |
| InChI | InChI=1S/C33H24ClN3O6S/c1-41-27-13-8-19(15-28(27)42-2)31-24-11-7-18-5-3-4-6-22(18)30(24)35-33-36(31)32(38)29(44-33)17-21-10-14-26(43-21)23-12-9-20(34)16-25(23)37(39)40/h3-6,8-10,12-17,31H,7,11H2,1-2H3/b29-17+/t31-/m1/s1 |
| InChIKey | QFXKQGPIRHQPFB-SELCLYCASA-N |
| XLogP | 6.16 |
| TPSA | 109.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.09 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|