C33H23Cl2N3O6S — CID 3542872
14-[[5-(2,5-dichloro-4-nitrophenyl)furan-2-yl]methylidene]-11-(2,5-dimethoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 3542872) has the molecular formula C33H23Cl2N3O6S and a molecular weight of 660.54 g/mol. Its IUPAC name is 14-[[5-(2,5-dichloro-4-nitrophenyl)furan-2-yl]methylidene]-11-(2,5-dimethoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | 14-[[5-(2,5-dichloro-4-nitrophenyl)furan-2-yl]methylidene]-11-(2,5-dimethoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 3542872 |
| Molecular Formula | C33H23Cl2N3O6S |
| Molecular Weight | 660.54 g/mol |
| Exact Mass | 659.07 |
| IUPAC Name | 14-[[5-(2,5-dichloro-4-nitrophenyl)furan-2-yl]methylidene]-11-(2,5-dimethoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | COc1ccc(OC)c(C2C3=C(N=c4sc(=Cc5ccc(-c6cc(Cl)c([N+](=O)[O-])cc6Cl)o5)c(=O)n42)c2ccccc2CC3)c1 |
| InChI | InChI=1S/C33H23Cl2N3O6S/c1-42-18-8-11-27(43-2)23(13-18)31-21-10-7-17-5-3-4-6-20(17)30(21)36-33-37(31)32(39)29(45-33)14-19-9-12-28(44-19)22-15-25(35)26(38(40)41)16-24(22)34/h3-6,8-9,11-16,31H,7,10H2,1-2H3 |
| InChIKey | OTCBKFQQCRTQAU-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 109.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.54 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|