C32H22ClN3O5S — CID 124538664
(11S,14E)-14-[[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylidene]-11-(2-methoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 124538664) has the molecular formula C32H22ClN3O5S and a molecular weight of 596.06 g/mol. Its IUPAC name is (11S,14E)-14-[[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylidene]-11-(2-methoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (11S,14E)-14-[[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylidene]-11-(2-methoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 124538664 |
| Molecular Formula | C32H22ClN3O5S |
| Molecular Weight | 596.06 g/mol |
| Exact Mass | 595.10 |
| IUPAC Name | (11S,14E)-14-[[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylidene]-11-(2-methoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | COc1ccccc1[C@@H]1C2=C(N=c3s/c(=C/c4ccc(-c5ccc(Cl)c([N+](=O)[O-])c5)o4)c(=O)n31)c1ccccc1CC2 |
| InChI | InChI=1S/C32H22ClN3O5S/c1-40-27-9-5-4-8-22(27)30-23-13-10-18-6-2-3-7-21(18)29(23)34-32-35(30)31(37)28(42-32)17-20-12-15-26(41-20)19-11-14-24(33)25(16-19)36(38)39/h2-9,11-12,14-17,30H,10,13H2,1H3/b28-17+/t30-/m1/s1 |
| InChIKey | QIQJBYDLGYWUJC-ITNPZBTBSA-N |
| XLogP | 6.15 |
| TPSA | 99.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.06 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|