C31H20ClN3O4S — CID 124531137
(11S,14E)-14-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-11-(3-nitrophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 124531137) has the molecular formula C31H20ClN3O4S and a molecular weight of 566.04 g/mol. Its IUPAC name is (11S,14E)-14-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-11-(3-nitrophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (11S,14E)-14-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-11-(3-nitrophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 124531137 |
| Molecular Formula | C31H20ClN3O4S |
| Molecular Weight | 566.04 g/mol |
| Exact Mass | 565.09 |
| IUPAC Name | (11S,14E)-14-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-11-(3-nitrophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | O=c1/c(=C\c2ccc(-c3cccc(Cl)c3)o2)sc2n1[C@@H](c1cccc([N+](=O)[O-])c1)C1=C(N=2)c2ccccc2CC1 |
| InChI | InChI=1S/C31H20ClN3O4S/c32-21-8-3-6-19(15-21)26-14-12-23(39-26)17-27-30(36)34-29(20-7-4-9-22(16-20)35(37)38)25-13-11-18-5-1-2-10-24(18)28(25)33-31(34)40-27/h1-10,12,14-17,29H,11,13H2/b27-17+/t29-/m0/s1 |
| InChIKey | HZVZUAIJWPHBFX-HRIDGTDGSA-N |
| XLogP | 6.14 |
| TPSA | 90.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.04 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|