C27H17Cl2N3O3S — CID 124531400
(11S,14E)-14-[(2,3-dichlorophenyl)methylidene]-11-(3-nitrophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 124531400) has the molecular formula C27H17Cl2N3O3S and a molecular weight of 534.42 g/mol. Its IUPAC name is (11S,14E)-14-[(2,3-dichlorophenyl)methylidene]-11-(3-nitrophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (11S,14E)-14-[(2,3-dichlorophenyl)methylidene]-11-(3-nitrophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 124531400 |
| Molecular Formula | C27H17Cl2N3O3S |
| Molecular Weight | 534.42 g/mol |
| Exact Mass | 533.04 |
| IUPAC Name | (11S,14E)-14-[(2,3-dichlorophenyl)methylidene]-11-(3-nitrophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | O=c1/c(=C\c2cccc(Cl)c2Cl)sc2n1[C@@H](c1cccc([N+](=O)[O-])c1)C1=C(N=2)c2ccccc2CC1 |
| InChI | InChI=1S/C27H17Cl2N3O3S/c28-21-10-4-6-16(23(21)29)14-22-26(33)31-25(17-7-3-8-18(13-17)32(34)35)20-12-11-15-5-1-2-9-19(15)24(20)30-27(31)36-22/h1-10,13-14,25H,11-12H2/b22-14+/t25-/m0/s1 |
| InChIKey | MHKYGHWNTCWVIM-MLJBDGAYSA-N |
| XLogP | 5.53 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.42 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|