C32H22FN3O4S — CID 124531160
(11S,14E)-11-(4-fluorophenyl)-14-[[5-(2-methyl-4-nitrophenyl)furan-2-yl]methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 124531160) has the molecular formula C32H22FN3O4S and a molecular weight of 563.61 g/mol. Its IUPAC name is (11S,14E)-11-(4-fluorophenyl)-14-[[5-(2-methyl-4-nitrophenyl)furan-2-yl]methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (11S,14E)-11-(4-fluorophenyl)-14-[[5-(2-methyl-4-nitrophenyl)furan-2-yl]methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 124531160 |
| Molecular Formula | C32H22FN3O4S |
| Molecular Weight | 563.61 g/mol |
| Exact Mass | 563.13 |
| IUPAC Name | (11S,14E)-11-(4-fluorophenyl)-14-[[5-(2-methyl-4-nitrophenyl)furan-2-yl]methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | Cc1cc([N+](=O)[O-])ccc1-c1ccc(/C=c2/sc3n(c2=O)[C@@H](c2ccc(F)cc2)C2=C(N=3)c3ccccc3CC2)o1 |
| InChI | InChI=1S/C32H22FN3O4S/c1-18-16-22(36(38)39)11-14-24(18)27-15-12-23(40-27)17-28-31(37)35-30(20-6-9-21(33)10-7-20)26-13-8-19-4-2-3-5-25(19)29(26)34-32(35)41-28/h2-7,9-12,14-17,30H,8,13H2,1H3/b28-17+/t30-/m0/s1 |
| InChIKey | DBANEBZAVVIMSJ-UAMLYEQYSA-N |
| XLogP | 5.93 |
| TPSA | 90.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.61 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|