C31H28Cl2N4O7S — CID 126104804
(2E,5S)-2-[[5-(2,5-dichloro-4-nitrophenyl)furan-2-yl]methylidene]-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 126104804) has the molecular formula C31H28Cl2N4O7S and a molecular weight of 671.56 g/mol. Its IUPAC name is (2E,5S)-2-[[5-(2,5-dichloro-4-nitrophenyl)furan-2-yl]methylidene]-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | (2E,5S)-2-[[5-(2,5-dichloro-4-nitrophenyl)furan-2-yl]methylidene]-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 126104804 |
| Molecular Formula | C31H28Cl2N4O7S |
| Molecular Weight | 671.56 g/mol |
| Exact Mass | 670.11 |
| IUPAC Name | (2E,5S)-2-[[5-(2,5-dichloro-4-nitrophenyl)furan-2-yl]methylidene]-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | CCN(CC)C(=O)C1=C(C)N=c2s/c(=C/c3ccc(-c4cc(Cl)c([N+](=O)[O-])cc4Cl)o3)c(=O)n2[C@H]1c1cc(OC)ccc1OC |
| InChI | InChI=1S/C31H28Cl2N4O7S/c1-6-35(7-2)30(39)27-16(3)34-31-36(28(27)20-12-17(42-4)8-10-24(20)43-5)29(38)26(45-31)13-18-9-11-25(44-18)19-14-22(33)23(37(40)41)15-21(19)32/h8-15,28H,6-7H2,1-5H3/b26-13+/t28-/m0/s1 |
| InChIKey | OXAIUYMGTTTZFT-INJWXVQMSA-N |
| XLogP | 5.60 |
| TPSA | 129.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.56 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|