C31H29Cl2N3O5S — CID 126109153
(2E,5R)-2-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 126109153) has the molecular formula C31H29Cl2N3O5S and a molecular weight of 626.56 g/mol. Its IUPAC name is (2E,5R)-2-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | (2E,5R)-2-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 126109153 |
| Molecular Formula | C31H29Cl2N3O5S |
| Molecular Weight | 626.56 g/mol |
| Exact Mass | 625.12 |
| IUPAC Name | (2E,5R)-2-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | CCN(CC)C(=O)C1=C(C)N=c2s/c(=C/c3ccc(-c4ccc(Cl)c(Cl)c4)o3)c(=O)n2[C@@H]1c1cc(OC)ccc1OC |
| InChI | InChI=1S/C31H29Cl2N3O5S/c1-6-35(7-2)30(38)27-17(3)34-31-36(28(27)21-15-19(39-4)9-13-25(21)40-5)29(37)26(42-31)16-20-10-12-24(41-20)18-8-11-22(32)23(33)14-18/h8-16,28H,6-7H2,1-5H3/b26-16+/t28-/m1/s1 |
| InChIKey | WDCRBPVWOOYRIC-UQDCTOEPSA-N |
| XLogP | 5.69 |
| TPSA | 86.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.56 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |