C25H25Br2N3O5S — CID 126107589
(2E,5R)-2-[(4,5-dibromofuran-2-yl)methylidene]-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 126107589) has the molecular formula C25H25Br2N3O5S and a molecular weight of 639.37 g/mol. Its IUPAC name is (2E,5R)-2-[(4,5-dibromofuran-2-yl)methylidene]-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | (2E,5R)-2-[(4,5-dibromofuran-2-yl)methylidene]-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 126107589 |
| Molecular Formula | C25H25Br2N3O5S |
| Molecular Weight | 639.37 g/mol |
| Exact Mass | 636.99 |
| IUPAC Name | (2E,5R)-2-[(4,5-dibromofuran-2-yl)methylidene]-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | CCN(CC)C(=O)C1=C(C)N=c2s/c(=C/c3cc(Br)c(Br)o3)c(=O)n2[C@@H]1c1cc(OC)ccc1OC |
| InChI | InChI=1S/C25H25Br2N3O5S/c1-6-29(7-2)24(32)20-13(3)28-25-30(21(20)16-10-14(33-4)8-9-18(16)34-5)23(31)19(36-25)12-15-11-17(26)22(27)35-15/h8-12,21H,6-7H2,1-5H3/b19-12+/t21-/m1/s1 |
| InChIKey | WMJHCTSNVILWDS-PRWBYUBPSA-N |
| XLogP | 4.24 |
| TPSA | 86.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |