C30H35N3O7S — CID 126099869
(2E,5S)-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-3-oxo-2-[(2,3,4-trimethoxyphenyl)methylidene]-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 126099869) has the molecular formula C30H35N3O7S and a molecular weight of 581.69 g/mol. Its IUPAC name is (2E,5S)-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-3-oxo-2-[(2,3,4-trimethoxyphenyl)methylidene]-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | (2E,5S)-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-3-oxo-2-[(2,3,4-trimethoxyphenyl)methylidene]-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 126099869 |
| Molecular Formula | C30H35N3O7S |
| Molecular Weight | 581.69 g/mol |
| Exact Mass | 581.22 |
| IUPAC Name | (2E,5S)-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-3-oxo-2-[(2,3,4-trimethoxyphenyl)methylidene]-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | CCN(CC)C(=O)C1=C(C)N=c2s/c(=C/c3ccc(OC)c(OC)c3OC)c(=O)n2[C@H]1c1cc(OC)ccc1OC |
| InChI | InChI=1S/C30H35N3O7S/c1-9-32(10-2)29(35)24-17(3)31-30-33(25(24)20-16-19(36-4)12-14-21(20)37-5)28(34)23(41-30)15-18-11-13-22(38-6)27(40-8)26(18)39-7/h11-16,25H,9-10H2,1-8H3/b23-15+/t25-/m0/s1 |
| InChIKey | AITCBYGEUYSLJE-XXMKCSCWSA-N |
| XLogP | 3.15 |
| TPSA | 100.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.69 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |