C29H32ClN3O6S — CID 126107335
(2E,5R)-2-[(3-chloro-4,5-dimethoxyphenyl)methylidene]-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 126107335) has the molecular formula C29H32ClN3O6S and a molecular weight of 586.11 g/mol. Its IUPAC name is (2E,5R)-2-[(3-chloro-4,5-dimethoxyphenyl)methylidene]-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | (2E,5R)-2-[(3-chloro-4,5-dimethoxyphenyl)methylidene]-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 126107335 |
| Molecular Formula | C29H32ClN3O6S |
| Molecular Weight | 586.11 g/mol |
| Exact Mass | 585.17 |
| IUPAC Name | (2E,5R)-2-[(3-chloro-4,5-dimethoxyphenyl)methylidene]-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | CCN(CC)C(=O)C1=C(C)N=c2s/c(=C/c3cc(Cl)c(OC)c(OC)c3)c(=O)n2[C@@H]1c1cc(OC)ccc1OC |
| InChI | InChI=1S/C29H32ClN3O6S/c1-8-32(9-2)28(35)24-16(3)31-29-33(25(24)19-15-18(36-4)10-11-21(19)37-5)27(34)23(40-29)14-17-12-20(30)26(39-7)22(13-17)38-6/h10-15,25H,8-9H2,1-7H3/b23-14+/t25-/m1/s1 |
| InChIKey | WJIRDGWUDGVARQ-AQIZGWBQSA-N |
| XLogP | 3.79 |
| TPSA | 91.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.11 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |