C33H25ClN4O3S — CID 4256790
11-(2-chlorophenyl)-14-[[2,5-dimethyl-1-(4-nitrophenyl)pyrrol-3-yl]methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 4256790) has the molecular formula C33H25ClN4O3S and a molecular weight of 593.11 g/mol. Its IUPAC name is 11-(2-chlorophenyl)-14-[[2,5-dimethyl-1-(4-nitrophenyl)pyrrol-3-yl]methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | 11-(2-chlorophenyl)-14-[[2,5-dimethyl-1-(4-nitrophenyl)pyrrol-3-yl]methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 4256790 |
| Molecular Formula | C33H25ClN4O3S |
| Molecular Weight | 593.11 g/mol |
| Exact Mass | 592.13 |
| IUPAC Name | 11-(2-chlorophenyl)-14-[[2,5-dimethyl-1-(4-nitrophenyl)pyrrol-3-yl]methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | Cc1cc(C=c2sc3n(c2=O)C(c2ccccc2Cl)C2=C(N=3)c3ccccc3CC2)c(C)n1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C33H25ClN4O3S/c1-19-17-22(20(2)36(19)23-12-14-24(15-13-23)38(40)41)18-29-32(39)37-31(26-9-5-6-10-28(26)34)27-16-11-21-7-3-4-8-25(21)30(27)35-33(37)42-29/h3-10,12-15,17-18,31H,11,16H2,1-2H3 |
| InChIKey | XNUFZVZRNDDRJU-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 82.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.11 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|