C33H26ClN3OS — CID 124531151
(11R,14E)-11-(4-chlorophenyl)-14-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 124531151) has the molecular formula C33H26ClN3OS and a molecular weight of 548.11 g/mol. Its IUPAC name is (11R,14E)-11-(4-chlorophenyl)-14-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (11R,14E)-11-(4-chlorophenyl)-14-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 124531151 |
| Molecular Formula | C33H26ClN3OS |
| Molecular Weight | 548.11 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | (11R,14E)-11-(4-chlorophenyl)-14-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | Cc1cc(/C=c2/sc3n(c2=O)[C@H](c2ccc(Cl)cc2)C2=C(N=3)c3ccccc3CC2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C33H26ClN3OS/c1-20-18-24(21(2)36(20)26-9-4-3-5-10-26)19-29-32(38)37-31(23-12-15-25(34)16-13-23)28-17-14-22-8-6-7-11-27(22)30(28)35-33(37)39-29/h3-13,15-16,18-19,31H,14,17H2,1-2H3/b29-19+/t31-/m1/s1 |
| InChIKey | FEHXBCMYLWEELM-ASUJOLEISA-N |
| XLogP | 6.38 |
| TPSA | 39.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.11 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|