C34H28BrN3O2S — CID 124531140
(11S,14E)-14-[[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-11-(3-methoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 124531140) has the molecular formula C34H28BrN3O2S and a molecular weight of 622.59 g/mol. Its IUPAC name is (11S,14E)-14-[[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-11-(3-methoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (11S,14E)-14-[[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-11-(3-methoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 124531140 |
| Molecular Formula | C34H28BrN3O2S |
| Molecular Weight | 622.59 g/mol |
| Exact Mass | 621.11 |
| IUPAC Name | (11S,14E)-14-[[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-11-(3-methoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | COc1cccc([C@H]2C3=C(N=c4s/c(=C/c5cc(C)n(-c6ccc(Br)cc6)c5C)c(=O)n42)c2ccccc2CC3)c1 |
| InChI | InChI=1S/C34H28BrN3O2S/c1-20-17-24(21(2)37(20)26-14-12-25(35)13-15-26)19-30-33(39)38-32(23-8-6-9-27(18-23)40-3)29-16-11-22-7-4-5-10-28(22)31(29)36-34(38)41-30/h4-10,12-15,17-19,32H,11,16H2,1-3H3/b30-19+/t32-/m0/s1 |
| InChIKey | TYASMWKWTYQRBA-SAGCDJCOSA-N |
| XLogP | 6.50 |
| TPSA | 48.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.59 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|