C33H25BrClN3OS — CID 11839115
(14E)-11-(4-bromophenyl)-14-[[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 11839115) has the molecular formula C33H25BrClN3OS and a molecular weight of 627.01 g/mol. Its IUPAC name is (14E)-11-(4-bromophenyl)-14-[[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (14E)-11-(4-bromophenyl)-14-[[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 11839115 |
| Molecular Formula | C33H25BrClN3OS |
| Molecular Weight | 627.01 g/mol |
| Exact Mass | 625.06 |
| IUPAC Name | (14E)-11-(4-bromophenyl)-14-[[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | Cc1cc(/C=c2/sc3n(c2=O)C(c2ccc(Br)cc2)C2=C(N=3)c3ccccc3CC2)c(C)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C33H25BrClN3OS/c1-19-17-23(20(2)37(19)26-14-12-25(35)13-15-26)18-29-32(39)38-31(22-7-10-24(34)11-8-22)28-16-9-21-5-3-4-6-27(21)30(28)36-33(38)40-29/h3-8,10-15,17-18,31H,9,16H2,1-2H3/b29-18+ |
| InChIKey | HWLUOIBTFSRMOJ-RDRPBHBLSA-N |
| XLogP | 7.14 |
| TPSA | 39.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.01 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|