C32H25N5O3S — CID 124531121
(11R,14Z)-14-[(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)methylidene]-11-(3-nitrophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 124531121) has the molecular formula C32H25N5O3S and a molecular weight of 559.65 g/mol. Its IUPAC name is (11R,14Z)-14-[(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)methylidene]-11-(3-nitrophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (11R,14Z)-14-[(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)methylidene]-11-(3-nitrophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 124531121 |
| Molecular Formula | C32H25N5O3S |
| Molecular Weight | 559.65 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | (11R,14Z)-14-[(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)methylidene]-11-(3-nitrophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | Cc1cc(/C=c2\sc3n(c2=O)[C@H](c2cccc([N+](=O)[O-])c2)C2=C(N=3)c3ccccc3CC2)c(C)n1-c1cccnc1 |
| InChI | InChI=1S/C32H25N5O3S/c1-19-15-23(20(2)35(19)25-10-6-14-33-18-25)17-28-31(38)36-30(22-8-5-9-24(16-22)37(39)40)27-13-12-21-7-3-4-11-26(21)29(27)34-32(36)41-28/h3-11,14-18,30H,12-13H2,1-2H3/b28-17-/t30-/m1/s1 |
| InChIKey | NWDUGPAACJNNSX-OBDCIHEFSA-N |
| XLogP | 5.03 |
| TPSA | 95.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.65 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|