C28H18Cl2N2O3S — CID 5071553
4-[[11-(2,4-dichlorophenyl)-13-oxo-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-14-ylidene]methyl]benzoic acid (PubChem CID 5071553) has the molecular formula C28H18Cl2N2O3S and a molecular weight of 533.44 g/mol. Its IUPAC name is 4-[[11-(2,4-dichlorophenyl)-13-oxo-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-14-ylidene]methyl]benzoic acid.
| Compound Name | 4-[[11-(2,4-dichlorophenyl)-13-oxo-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-14-ylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 5071553 |
| Molecular Formula | C28H18Cl2N2O3S |
| Molecular Weight | 533.44 g/mol |
| Exact Mass | 532.04 |
| IUPAC Name | 4-[[11-(2,4-dichlorophenyl)-13-oxo-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-14-ylidene]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C=c2sc3n(c2=O)C(c2ccc(Cl)cc2Cl)C2=C(N=3)c3ccccc3CC2)cc1 |
| InChI | InChI=1S/C28H18Cl2N2O3S/c29-18-10-12-20(22(30)14-18)25-21-11-9-16-3-1-2-4-19(16)24(21)31-28-32(25)26(33)23(36-28)13-15-5-7-17(8-6-15)27(34)35/h1-8,10,12-14,25H,9,11H2,(H,34,35) |
| InChIKey | KLCCDGIBXWHVCE-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 71.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.44 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |