C27H20N2O2S — CID 3480132
14-[(4-hydroxyphenyl)methylidene]-11-phenyl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 3480132) has the molecular formula C27H20N2O2S and a molecular weight of 436.54 g/mol. Its IUPAC name is 14-[(4-hydroxyphenyl)methylidene]-11-phenyl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | 14-[(4-hydroxyphenyl)methylidene]-11-phenyl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 3480132 |
| Molecular Formula | C27H20N2O2S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 14-[(4-hydroxyphenyl)methylidene]-11-phenyl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | O=c1c(=Cc2ccc(O)cc2)sc2n1C(c1ccccc1)C1=C(N=2)c2ccccc2CC1 |
| InChI | InChI=1S/C27H20N2O2S/c30-20-13-10-17(11-14-20)16-23-26(31)29-25(19-7-2-1-3-8-19)22-15-12-18-6-4-5-9-21(18)24(22)28-27(29)32-23/h1-11,13-14,16,25,30H,12,15H2 |
| InChIKey | VVCACAJMACBKAV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |