C43H31N3OS — CID 124597820
(11R,14E)-11-phenyl-14-[(1,2,5-triphenylpyrrol-3-yl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 124597820) has the molecular formula C43H31N3OS and a molecular weight of 637.81 g/mol. Its IUPAC name is (11R,14E)-11-phenyl-14-[(1,2,5-triphenylpyrrol-3-yl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (11R,14E)-11-phenyl-14-[(1,2,5-triphenylpyrrol-3-yl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 124597820 |
| Molecular Formula | C43H31N3OS |
| Molecular Weight | 637.81 g/mol |
| Exact Mass | 637.22 |
| IUPAC Name | (11R,14E)-11-phenyl-14-[(1,2,5-triphenylpyrrol-3-yl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | O=c1/c(=C\c2cc(-c3ccccc3)n(-c3ccccc3)c2-c2ccccc2)sc2n1[C@H](c1ccccc1)C1=C(N=2)c2ccccc2CC1 |
| InChI | InChI=1S/C43H31N3OS/c47-42-38(48-43-44-39-35-24-14-13-15-29(35)25-26-36(39)41(46(42)43)32-20-9-3-10-21-32)28-33-27-37(30-16-5-1-6-17-30)45(34-22-11-4-12-23-34)40(33)31-18-7-2-8-19-31/h1-24,27-28,41H,25-26H2/b38-28+/t41-/m1/s1 |
| InChIKey | NGALYAGHBDUYJN-PGZGAAMCSA-N |
| XLogP | 8.44 |
| TPSA | 39.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.81 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |