C43H30N4O3S — CID 124597828
(11R,14E)-14-[[1-(4-nitrophenyl)-2,5-diphenylpyrrol-3-yl]methylidene]-11-phenyl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 124597828) has the molecular formula C43H30N4O3S and a molecular weight of 682.81 g/mol. Its IUPAC name is (11R,14E)-14-[[1-(4-nitrophenyl)-2,5-diphenylpyrrol-3-yl]methylidene]-11-phenyl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (11R,14E)-14-[[1-(4-nitrophenyl)-2,5-diphenylpyrrol-3-yl]methylidene]-11-phenyl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 124597828 |
| Molecular Formula | C43H30N4O3S |
| Molecular Weight | 682.81 g/mol |
| Exact Mass | 682.20 |
| IUPAC Name | (11R,14E)-14-[[1-(4-nitrophenyl)-2,5-diphenylpyrrol-3-yl]methylidene]-11-phenyl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | O=c1/c(=C\c2cc(-c3ccccc3)n(-c3ccc([N+](=O)[O-])cc3)c2-c2ccccc2)sc2n1[C@H](c1ccccc1)C1=C(N=2)c2ccccc2CC1 |
| InChI | InChI=1S/C43H30N4O3S/c48-42-38(51-43-44-39-35-19-11-10-12-28(35)20-25-36(39)41(46(42)43)31-17-8-3-9-18-31)27-32-26-37(29-13-4-1-5-14-29)45(40(32)30-15-6-2-7-16-30)33-21-23-34(24-22-33)47(49)50/h1-19,21-24,26-27,41H,20,25H2/b38-27+/t41-/m1/s1 |
| InChIKey | GWUFUYKARZWOOT-YCBDPUBJSA-N |
| XLogP | 8.35 |
| TPSA | 82.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.81 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|