C27H17Br2N3O4S — CID 124597258
(11S,14Z)-14-[(3-bromo-2-hydroxy-5-nitrophenyl)methylidene]-11-(4-bromophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 124597258) has the molecular formula C27H17Br2N3O4S and a molecular weight of 639.33 g/mol. Its IUPAC name is (11S,14Z)-14-[(3-bromo-2-hydroxy-5-nitrophenyl)methylidene]-11-(4-bromophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (11S,14Z)-14-[(3-bromo-2-hydroxy-5-nitrophenyl)methylidene]-11-(4-bromophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 124597258 |
| Molecular Formula | C27H17Br2N3O4S |
| Molecular Weight | 639.33 g/mol |
| Exact Mass | 636.93 |
| IUPAC Name | (11S,14Z)-14-[(3-bromo-2-hydroxy-5-nitrophenyl)methylidene]-11-(4-bromophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | O=c1/c(=C/c2cc([N+](=O)[O-])cc(Br)c2O)sc2n1[C@@H](c1ccc(Br)cc1)C1=C(N=2)c2ccccc2CC1 |
| InChI | InChI=1S/C27H17Br2N3O4S/c28-17-8-5-15(6-9-17)24-20-10-7-14-3-1-2-4-19(14)23(20)30-27-31(24)26(34)22(37-27)12-16-11-18(32(35)36)13-21(29)25(16)33/h1-6,8-9,11-13,24,33H,7,10H2/b22-12-/t24-/m0/s1 |
| InChIKey | BYUIOKMRXAPUFT-IZBTWGKQSA-N |
| XLogP | 5.46 |
| TPSA | 97.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.33 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|