C27H17BrFN3O4S — CID 4921641
14-[(3-bromo-2-hydroxy-5-nitrophenyl)methylidene]-11-(4-fluorophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 4921641) has the molecular formula C27H17BrFN3O4S and a molecular weight of 578.42 g/mol. Its IUPAC name is 14-[(3-bromo-2-hydroxy-5-nitrophenyl)methylidene]-11-(4-fluorophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | 14-[(3-bromo-2-hydroxy-5-nitrophenyl)methylidene]-11-(4-fluorophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 4921641 |
| Molecular Formula | C27H17BrFN3O4S |
| Molecular Weight | 578.42 g/mol |
| Exact Mass | 577.01 |
| IUPAC Name | 14-[(3-bromo-2-hydroxy-5-nitrophenyl)methylidene]-11-(4-fluorophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | O=c1c(=Cc2cc([N+](=O)[O-])cc(Br)c2O)sc2n1C(c1ccc(F)cc1)C1=C(N=2)c2ccccc2CC1 |
| InChI | InChI=1S/C27H17BrFN3O4S/c28-21-13-18(32(35)36)11-16(25(21)33)12-22-26(34)31-24(15-5-8-17(29)9-6-15)20-10-7-14-3-1-2-4-19(14)23(20)30-27(31)37-22/h1-6,8-9,11-13,24,33H,7,10H2 |
| InChIKey | WFNZFVSTQKFNFU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 97.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.42 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|