C31H25FN4O3S — CID 4579162
11-(4-fluorophenyl)-14-[(3-nitro-4-pyrrolidin-1-ylphenyl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 4579162) has the molecular formula C31H25FN4O3S and a molecular weight of 552.63 g/mol. Its IUPAC name is 11-(4-fluorophenyl)-14-[(3-nitro-4-pyrrolidin-1-ylphenyl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | 11-(4-fluorophenyl)-14-[(3-nitro-4-pyrrolidin-1-ylphenyl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 4579162 |
| Molecular Formula | C31H25FN4O3S |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | 11-(4-fluorophenyl)-14-[(3-nitro-4-pyrrolidin-1-ylphenyl)methylidene]-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | O=c1c(=Cc2ccc(N3CCCC3)c([N+](=O)[O-])c2)sc2n1C(c1ccc(F)cc1)C1=C(N=2)c2ccccc2CC1 |
| InChI | InChI=1S/C31H25FN4O3S/c32-22-11-8-21(9-12-22)29-24-13-10-20-5-1-2-6-23(20)28(24)33-31-35(29)30(37)27(40-31)18-19-7-14-25(26(17-19)36(38)39)34-15-3-4-16-34/h1-2,5-9,11-12,14,17-18,29H,3-4,10,13,15-16H2 |
| InChIKey | YSVGJTOFNXOOTP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 80.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|