C30H25N3O5S — CID 23832502
14-[(4-ethoxy-3-nitrophenyl)methylidene]-11-(4-methoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 23832502) has the molecular formula C30H25N3O5S and a molecular weight of 539.61 g/mol. Its IUPAC name is 14-[(4-ethoxy-3-nitrophenyl)methylidene]-11-(4-methoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | 14-[(4-ethoxy-3-nitrophenyl)methylidene]-11-(4-methoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 23832502 |
| Molecular Formula | C30H25N3O5S |
| Molecular Weight | 539.61 g/mol |
| Exact Mass | 539.15 |
| IUPAC Name | 14-[(4-ethoxy-3-nitrophenyl)methylidene]-11-(4-methoxyphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | CCOc1ccc(C=c2sc3n(c2=O)C(c2ccc(OC)cc2)C2=C(N=3)c3ccccc3CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C30H25N3O5S/c1-3-38-25-15-8-18(16-24(25)33(35)36)17-26-29(34)32-28(20-9-12-21(37-2)13-10-20)23-14-11-19-6-4-5-7-22(19)27(23)31-30(32)39-26/h4-10,12-13,15-17,28H,3,11,14H2,1-2H3 |
| InChIKey | KXGSSJJBLIIDKZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 95.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.61 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|