C23H17N3O4S — CID 6341900
(2E,5S)-2-[(4-nitrophenyl)methylidene]-5-phenyl-5,7,8,9-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione (PubChem CID 6341900) has the molecular formula C23H17N3O4S and a molecular weight of 431.47 g/mol. Its IUPAC name is (2E,5S)-2-[(4-nitrophenyl)methylidene]-5-phenyl-5,7,8,9-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione.
| Compound Name | (2E,5S)-2-[(4-nitrophenyl)methylidene]-5-phenyl-5,7,8,9-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione |
|---|---|
| PubChem CID | 6341900 |
| Molecular Formula | C23H17N3O4S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | (2E,5S)-2-[(4-nitrophenyl)methylidene]-5-phenyl-5,7,8,9-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione |
| SMILES | O=C1CCCC2=C1[C@H](c1ccccc1)n1c(s/c(=C/c3ccc([N+](=O)[O-])cc3)c1=O)=N2 |
| InChI | InChI=1S/C23H17N3O4S/c27-18-8-4-7-17-20(18)21(15-5-2-1-3-6-15)25-22(28)19(31-23(25)24-17)13-14-9-11-16(12-10-14)26(29)30/h1-3,5-6,9-13,21H,4,7-8H2/b19-13+/t21-/m0/s1 |
| InChIKey | PPDJWJDBXCCVRO-YMFQVDJJSA-N |
| XLogP | 2.88 |
| TPSA | 94.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|