C25H21ClN2O2S — CID 23884985
5-(4-chlorophenyl)-2-[(4-ethylphenyl)methylidene]-5,7,8,9-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione (PubChem CID 23884985) has the molecular formula C25H21ClN2O2S and a molecular weight of 448.98 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[(4-ethylphenyl)methylidene]-5,7,8,9-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione.
| Compound Name | 5-(4-chlorophenyl)-2-[(4-ethylphenyl)methylidene]-5,7,8,9-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione |
|---|---|
| PubChem CID | 23884985 |
| Molecular Formula | C25H21ClN2O2S |
| Molecular Weight | 448.98 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[(4-ethylphenyl)methylidene]-5,7,8,9-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione |
| SMILES | CCc1ccc(C=c2sc3n(c2=O)C(c2ccc(Cl)cc2)C2=C(CCCC2=O)N=3)cc1 |
| InChI | InChI=1S/C25H21ClN2O2S/c1-2-15-6-8-16(9-7-15)14-21-24(30)28-23(17-10-12-18(26)13-11-17)22-19(27-25(28)31-21)4-3-5-20(22)29/h6-14,23H,2-5H2,1H3 |
| InChIKey | KWFIOIGPBKQTCU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 51.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.98 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |