C23H16Cl2N2O2S — CID 23931498
5-(4-chlorophenyl)-2-[(3-chlorophenyl)methylidene]-5,7,8,9-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione (PubChem CID 23931498) has the molecular formula C23H16Cl2N2O2S and a molecular weight of 455.37 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[(3-chlorophenyl)methylidene]-5,7,8,9-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione.
| Compound Name | 5-(4-chlorophenyl)-2-[(3-chlorophenyl)methylidene]-5,7,8,9-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione |
|---|---|
| PubChem CID | 23931498 |
| Molecular Formula | C23H16Cl2N2O2S |
| Molecular Weight | 455.37 g/mol |
| Exact Mass | 454.03 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[(3-chlorophenyl)methylidene]-5,7,8,9-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline-3,6-dione |
| SMILES | O=C1CCCC2=C1C(c1ccc(Cl)cc1)n1c(sc(=Cc3cccc(Cl)c3)c1=O)=N2 |
| InChI | InChI=1S/C23H16Cl2N2O2S/c24-15-9-7-14(8-10-15)21-20-17(5-2-6-18(20)28)26-23-27(21)22(29)19(30-23)12-13-3-1-4-16(25)11-13/h1,3-4,7-12,21H,2,5-6H2 |
| InChIKey | GHSXAXPACGQPPJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 51.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.37 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |